On Target ACE2_HUMAN 0.40127388/CHEMBL253224
For the given ligand Nelfinavir, we have found in our database that, being scored 0.40127388, the most similar ligand is CHEMBL253224. Check out the elaboration below.
| Nelfinavir (Given Ligand) | CHEMBL253224 (Similar Ligand) |
|---|---|
| Cc1c(O)cccc1C(=O)N[C@@H](CSc2ccccc2)[C@H](O)CN4C[C@H]3CCCC[C@H]3C[C@H]4C(=O)NC(C)(C)C | CC[C@@H](C)[C@H](S)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)O |
|
|
|
|
|
|
| 00010008 45805e08 20120100 1c110600 00000080 80008000 02000000 22001000 04000000 020049e0 00600000 7005b000 0601880a 00242102 86180400 20082008 14000000 02000000 02006000 00020301 80020000 390a8610 03800501 0654001d 00002000 c0000000 00004200 90000010 08001100 00060011 b0064000 03012220 | 00010000 01005008 20100100 00110600 00000080 00000000 82000000 20000004 00000880 020a08c0 08300000 4001b000 06008002 00040000 80080000 00080008 10000000 02000000 00400008 00020201 00000100 18200e00 03000140 85500018 00000800 80000000 00120000 10000040 04000000 00060003 20004000 03012600 |