On Target NS3_HCV1B 0.3472222/CHEMBL3954962
For the given ligand Nelfinavir, we have found in our database that, being scored 0.3472222, the most similar ligand is CHEMBL3954962. Check out the elaboration below.
| Nelfinavir (Given Ligand) | CHEMBL3954962 (Similar Ligand) |
|---|---|
| Cc1c(O)cccc1C(=O)N[C@@H](CSc2ccccc2)[C@H](O)CN4C[C@H]3CCCC[C@H]3C[C@H]4C(=O)NC(C)(C)C | C=CC(=O)NC[C@H](NC(=O)[C@@H](NC(=O)c1cnccn1)C1CCCCC1)C(=O)N1C[C@@H]2CCC[C@@H]2[C@H]1C(=O)N[C@@H](CCC)C(OC(=O)C(F)(F)F)C(=O)NC1CC1 |
|
|
|
|
|
|
| 00010008 45805e08 20120100 1c110600 00000080 80008000 02000000 22001000 04000000 020049e0 00600000 7005b000 0601880a 00242102 86180400 20082008 14000000 02000000 02006000 00020301 80020000 390a8610 03800501 0654001d 00002000 c0000000 00004200 90000010 08001100 00060011 b0064000 03012220 | 10018002 01807400 00100b00 94010f10 000800c0 00100010 0000c00c 20003409 11000000 000101a0 01290000 4001f000 0e00801a 01112001 809a1408 000c110c 18860000 82000103 02402010 00001205 80000120 300f8e30 33004003 0250001c 00141400 00000000 08880000 90000005 08000204 01060813 a4024000 82002600 |