On Target PR_HIV1 0.35390946/CHEMBL494500
For the given ligand Tipranavir, we have found in our database that, being scored 0.35390946, the most similar ligand is CHEMBL494500. Check out the elaboration below.
| Tipranavir (Given Ligand) | CHEMBL494500 (Similar Ligand) |
|---|---|
| CCC[C@@]4(CCc1ccccc1)C/C(O)=C([C@H](CC)c3cccc(NS(=O)(=O)c2ccc(C(F)(F)F)cn2)c3)\C(=O)O4 | COc1ccc(S(=O)(=O)N(CC(C)C)C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)O[C@H]2CCCOCC2)cc1 |
|
|
|
|
|
|
| 0005005a 01001008 01104942 10b10310 000c1048 00e00000 82000e81 08001402 01400800 01980850 48902204 60009000 84068c00 02a00803 80281444 000e120c 00822420 02100004 21652018 0100e801 e0000120 18208a80 2184a060 08400018 00241c82 90000400 08406020 9000002c 00404602 2006001a 24120000 00010670 | 00000050 01c05408 2110010a 01b10700 002810c0 00028000 02000000 a0000004 00540a00 014809e0 08342000 60018000 00008002 00a00101 81e80001 001a1008 10822000 02080000 11402800 01027603 80000120 18280c90 03100040 d9500058 02000400 8000100e 00800000 1020008c 04000600 2006001b 80000000 00012670 |