On Target NS5B_HCV1A 0.29666665/CHEMBL3644887
For the given ligand Tipranavir, we have found in our database that, being scored 0.29666665, the most similar ligand is CHEMBL3644887. Check out the elaboration below.
| Tipranavir (Given Ligand) | CHEMBL3644887 (Similar Ligand) |
|---|---|
| CCC[C@@]4(CCc1ccccc1)C/C(O)=C([C@H](CC)c3cccc(NS(=O)(=O)c2ccc(C(F)(F)F)cn2)c3)\C(=O)O4 | C=C[C@@H]1C[C@]1(NC(=O)[C@@H]1CN(S(=O)(=O)c2cccc3cccnc23)CN1C(=O)[C@@H](NC(=O)OC1CCCC1)C(C)(C)C)C(=O)NS(=O)(=O)C1CC1 |
|
|
|
|
|
|
| 0005005a 01001008 01104942 10b10310 000c1048 00e00000 82000e81 08001402 01400800 01980850 48902204 60009000 84068c00 02a00803 80281444 000e120c 00822420 02100004 21652018 0100e801 e0000120 18208a80 2184a060 08400018 00241c82 90000400 08406020 9000002c 00404602 2006001a 24120000 00010670 | 00010092 0dc03400 01384100 17b10f00 000c0000 00018000 080a0004 a0003408 10800200 0052b9e8 00302414 e201b400 0e00f802 01442141 80e00440 001e800c 02826014 00082000 40610850 00007603 c0003100 bc05ae18 21802003 ba440038 02012000 0002100e c0000000 9020062c 08800600 a1060093 a41c40a2 01012370 |