On Target NS5B_HCV1A 0.38121548/CHEMBL13256
For the given ligand Nelfinavir, we have found in our database that, being scored 0.38121548, the most similar ligand is CHEMBL13256. Check out the elaboration below.
| Nelfinavir (Given Ligand) | CHEMBL13256 (Similar Ligand) |
|---|---|
| Cc1c(O)cccc1C(=O)N[C@@H](CSc2ccccc2)[C@H](O)CN4C[C@H]3CCCC[C@H]3C[C@H]4C(=O)NC(C)(C)C | CC[C@H](NC(=O)[C@H](CC1CCCCC1)NC(=O)[C@@H](NC(=O)[C@H](CC(C)C)NC(=O)c1cnccn1)[C@@H](C)CC)C(=O)C(=O)NCC(=O)O |
|
|
|
|
|
|
| 00010008 45805e08 20120100 1c110600 00000080 80008000 02000000 22001000 04000000 020049e0 00600000 7005b000 0601880a 00242102 86180400 20082008 14000000 02000000 02006000 00020301 80020000 390a8610 03800501 0654001d 00002000 c0000000 00004200 90000010 08001100 00060011 b0064000 03012220 | 10018002 01807400 00100800 14000c10 000000c0 00100000 0000c000 20003009 14000000 000101a0 01292000 40013000 0e00800a 00102003 808a0400 000c010c 18020000 02000003 02002010 00000201 80000000 300f8e10 23004003 02100018 00141000 00000000 08000000 90000004 08000004 00060811 a0024000 80002200 |