On Target NS5B_HCV1B 0.27407408/CHEMBL3645191
For the given ligand Eltrombopag, we have found in our database that, being scored 0.27407408, the most similar ligand is CHEMBL3645191. Check out the elaboration below.
| Eltrombopag (Given Ligand) | CHEMBL3645191 (Similar Ligand) |
|---|---|
| Cc4ccc(n3nc(C)c(=NNc2cccc(c1cccc(C(=O)O)c1)c2O)c3=O)cc4C | CCCC(=O)NCCCN(c1cc2nn(-c3ccc(Br)cc3)c(C(=O)NC)c2cc1C1CC1)S(C)(=O)=O |
|
|
|
|
|
|
| 01b26006 00000808 603a0180 20031600 24000005 04006440 12001801 21004002 02008180 200008d1 002b000c 40009000 05408002 00308000 00820240 28086008 00060040 02001000 0c000400 40220a03 c0180000 1c020e21 f0002800 00604014 00040000 88480002 50000200 500000c1 1041c000 000e0003 c0200202 00000200 | 00004006 0080de08 20180902 41310e00 210c0000 00004042 02040000 22001408 00100900 004909e0 09312024 40119800 84008c33 01400201 808a0040 000e200e 04268000 02000004 08600008 00225203 e0100101 1c8b8e38 2080c800 9360001c 02104080 c0000048 00270080 9000108c 0c488104 0046005b c4048088 a81167e0 |