On Target NA_INFB 0.34649122/CHEMBL79499
For the given ligand Tipranavir, we have found in our database that, being scored 0.34649122, the most similar ligand is CHEMBL79499. Check out the elaboration below.
| Tipranavir (Given Ligand) | CHEMBL79499 (Similar Ligand) |
|---|---|
| CCC[C@@]4(CCc1ccccc1)C/C(O)=C([C@H](CC)c3cccc(NS(=O)(=O)c2ccc(C(F)(F)F)cn2)c3)\C(=O)O4 | CC[C@H](CCc1ccccc1)O[C@@H]1C=C(C(=O)O)C[C@H](N)[C@H]1NC(C)=O |
|
|
|
|
|
|
| 0005005a 01001008 01104942 10b10310 000c1048 00e00000 82000e81 08001402 01400800 01980850 48902204 60009000 84068c00 02a00803 80281444 000e120c 00822420 02100004 21652018 0100e801 e0000120 18208a80 2184a060 08400018 00241c82 90000400 08406020 9000002c 00404602 2006001a 24120000 00010670 | 00070040 09007008 00100102 80010700 00180080 00000800 02080180 38000402 11000800 001808c8 48300000 41019001 0402801a 01a80000 00001408 00081008 10a04000 02000060 60c12010 00000201 00000120 38040e80 13008040 02500018 10001400 80001400 00c04000 90000001 0c000202 00060403 04020000 00000610 |