On Target NA_INFB 0.33139536/CHEMBL473062
For the given ligand Nelfinavir, we have found in our database that, being scored 0.33139536, the most similar ligand is CHEMBL473062. Check out the elaboration below.
| Nelfinavir (Given Ligand) | CHEMBL473062 (Similar Ligand) |
|---|---|
| Cc1c(O)cccc1C(=O)N[C@@H](CSc2ccccc2)[C@H](O)CN4C[C@H]3CCCC[C@H]3C[C@H]4C(=O)NC(C)(C)C | C/C=C\[C@@H]1C[C@H](C(=O)O)N[C@H]1[C@@H](NC(C)=O)[C@](C)(CCC)OC |
|
|
|
|
|
|
| 00010008 45805e08 20120100 1c110600 00000080 80008000 02000000 22001000 04000000 020049e0 00600000 7005b000 0601880a 00242102 86180400 20082008 14000000 02000000 02006000 00020301 80020000 390a8610 03800501 0654001d 00002000 c0000000 00004200 90000010 08001100 00060011 b0064000 03012220 | 00010000 09007000 00100100 04010500 00080080 00000010 00080000 20000408 10000000 00108088 00200000 4001b000 0602801a 01802001 80181400 00080008 10a04000 00000040 00c02000 00000201 00000000 30040e30 13008081 02100018 00000001 00000000 00c04000 90000001 0c000200 00040401 24024000 00002200 |