On Target NA_INFB 0.22633745/CHEMBL4175983
For the given ligand Eltrombopag, we have found in our database that, being scored 0.22633745, the most similar ligand is CHEMBL4175983. Check out the elaboration below.
| Eltrombopag (Given Ligand) | CHEMBL4175983 (Similar Ligand) |
|---|---|
| Cc4ccc(n3nc(C)c(=NNc2cccc(c1cccc(C(=O)O)c1)c2O)c3=O)cc4C | CCC(CC)O[C@@H]1C=C(C(=O)O)C[C@H](NCc2ccc(N3CCCC3)cc2)[C@H]1NC(C)=O |
|
|
|
|
|
|
| 01b26006 00000808 603a0180 20031600 24000005 04006440 12001801 21004002 02008180 200008d1 002b000c 40009000 05408002 00308000 00820240 28086008 00060040 02001000 0c000400 40220a03 c0180000 1c020e21 f0002800 00604014 00040000 88480002 50000200 500000c1 1041c000 000e0003 c0200202 00000200 | 00074042 09007800 00100100 84010700 20180080 00002810 02080180 3a00140a 11000000 001108c8 40200004 41019001 0402881a 0188a000 00021448 00081008 10a44000 02000060 68c12010 00000201 40100020 38048e80 33008080 02500018 10001401 c0001400 00c04000 90000081 0c008300 00060401 24060000 00800a10 |