On Target PR_SARS 0.19736843/CHEMBL2441741
For the given ligand Conivaptan, we have found in our database that, being scored 0.19736843, the most similar ligand is CHEMBL2441741. Check out the elaboration below.
| Conivaptan (Given Ligand) | CHEMBL2441741 (Similar Ligand) |
|---|---|
| Cc6nc5c1ccccc1N(C(=O)c4ccc(NC(=O)c2ccccc2c3ccccc3)cc4)CCc5[nH]6 | CC(C)C[C@H](NC(=O)[C@H](Cc1cccc2ccccc12)NC(=O)OCc1ccccc1)C(=O)N[C@H](C=O)C[C@@H]1CCNC1=O |
|
|
|
|
|
|
| 0c00e202 00001801 00110100 91010e10 24000060 00008048 00002000 0208304c 00400180 10090a50 20298104 4000c800 03008802 00308001 a1020440 800c0006 04268200 1a002000 0c002000 40400200 44120800 18228600 31016020 1044001d 10841001 c1080280 00000210 800050c0 0401c104 03660c01 e0040820 20000200 | 01030000 01403200 00100100 04010600 00000000 0001c010 00000000 2000000c 00e00b00 000a08c0 08300000 4003b000 0e00801a 00012001 80000000 021e0008 00020000 02080400 00002898 00000201 00000100 38240e38 00000003 83500018 00000800 80002002 00000000 10200020 0c000200 0006000b e0004000 00802600 |