On Target PLP_SARS 0.42328042/CHEMBL358279
For the given ligand Conivaptan, we have found in our database that, being scored 0.42328042, the most similar ligand is CHEMBL358279. Check out the elaboration below.
| Conivaptan (Given Ligand) | CHEMBL358279 (Similar Ligand) |
|---|---|
| Cc6nc5c1ccccc1N(C(=O)c4ccc(NC(=O)c2ccccc2c3ccccc3)cc4)CCc5[nH]6 | NC(=O)c1ccc2c(c1)C(=O)C(=O)N2Cc1ccc2ccccc2c1 |
|
|
|
|
|
|
| 0c00e202 00001801 00110100 91010e10 24000060 00008048 00002000 0208304c 00400180 10090a50 20298104 4000c800 03008802 00308001 a1020440 800c0006 04268200 1a002000 0c002000 40400200 44120800 18228600 31016020 1044001d 10841001 c1080280 00000210 800050c0 0401c104 03660c01 e0040820 20000200 | 1000c002 00800800 00100100 80010600 20001001 00010040 00800000 02081000 04800080 00080e40 08280004 4000f000 03008802 00108000 40020540 08080008 00048000 02000000 08000400 00000200 c0100400 18228608 20012000 8144001d 00000000 c0000280 08000010 80005080 04088100 00060003 a0047000 20000600 |