On Target NSP1_SARS 0.22357723/CHEMBL2441745
For the given ligand Tipranavir, we have found in our database that, being scored 0.22357723, the most similar ligand is CHEMBL2441745. Check out the elaboration below.
| Tipranavir (Given Ligand) | CHEMBL2441745 (Similar Ligand) |
|---|---|
| CCC[C@@]4(CCc1ccccc1)C/C(O)=C([C@H](CC)c3cccc(NS(=O)(=O)c2ccc(C(F)(F)F)cn2)c3)\C(=O)O4 | CC(C)C[C@H](NC(=O)[C@H](Cc1cccc2ccccc12)NC(=O)OCc1ccccc1)C(=O)N[C@@H](C[C@@H]1CCNC1=O)C(=O)C(=O)NC(C)C |
|
|
|
|
|
|
| 0005005a 01001008 01104942 10b10310 000c1048 00e00000 82000e81 08001402 01400800 01980850 48902204 60009000 84068c00 02a00803 80281444 000e120c 00822420 02100004 21652018 0100e801 e0000120 18208a80 2184a060 08400018 00241c82 90000400 08406020 9000002c 00404602 2006001a 24120000 00010670 | 01030000 01403600 00100100 04010600 00000000 0001c010 00000000 2000000c 04e00b00 000a09e0 08300000 4003b000 0e00801a 00012001 80000000 021e0008 00020000 02080401 00002898 00000201 00000100 382c0e38 00000003 83500018 00001800 80002002 00000000 10200020 0c000200 0006001b e0024000 00802600 |