On Target RT_HIV1 0.2857143/CHEMBL4227382
For the given ligand Eltrombopag, we have found in our database that, being scored 0.2857143, the most similar ligand is CHEMBL4227382. Check out the elaboration below.
| Eltrombopag (Given Ligand) | CHEMBL4227382 (Similar Ligand) |
|---|---|
| Cc4ccc(n3nc(C)c(=NNc2cccc(c1cccc(C(=O)O)c1)c2O)c3=O)cc4C | C=C(C)[C@@H]1CC[C@]2(CNCCCN(C)c3ccccc3)CC[C@]3(C)[C@H](CC[C@@H]4[C@@]5(C)CC=C(c6ccc(C(=O)O)cc6)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]12 |
|
|
|
|
|
|
| 01b26006 00000808 603a0180 20031600 24000005 04006440 12001801 21004002 02008180 200008d1 002b000c 40009000 05408002 00308000 00820240 28086008 00060040 02001000 0c000400 40220a03 c0180000 1c020e21 f0002800 00604014 00040000 88480002 50000200 500000c1 1041c000 000e0003 c0200202 00000200 | 00004002 01000c00 00100302 40050600 20000000 00004000 80000080 20000402 00000900 001809e0 08300004 40018800 00028002 00200000 00020442 00080008 00040400 02000020 0a012000 00000201 61100100 18020a30 20008020 00500014 01200000 80000000 00406000 d0000080 00408002 01060012 e4020000 00002600 |