On Target PR_HIV1 0.188/CHEMBL523528
For the given ligand Eltrombopag, we have found in our database that, being scored 0.188, the most similar ligand is CHEMBL523528. Check out the elaboration below.
| Eltrombopag (Given Ligand) | CHEMBL523528 (Similar Ligand) |
|---|---|
| Cc4ccc(n3nc(C)c(=NNc2cccc(c1cccc(C(=O)O)c1)c2O)c3=O)cc4C | COc1ccc(S(=O)(=O)N(CC(C)C)C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)OC2COCOC2)cc1 |
|
|
|
|
|
|
| 01b26006 00000808 603a0180 20031600 24000005 04006440 12001801 21004002 02008180 200008d1 002b000c 40009000 05408002 00308000 00820240 28086008 00060040 02001000 0c000400 40220a03 c0180000 1c020e21 f0002800 00604014 00040000 88480002 50000200 500000c1 1041c000 000e0003 c0200202 00000200 | 00000010 01c05409 2110050a 01b10600 00081080 00028000 02802800 20000004 00742a00 014809e0 08302000 60018010 00008002 00200001 81e80001 003a0008 10022000 02080000 01400800 01027603 80100100 18280c90 07100040 d9500058 02000000 8000000e 00800000 342000cc 04000600 20060013 80000000 00012670 |