On Target PLP_SARS 0.3423913/CHEMBL358279
For the given ligand Imatinib, we have found in our database that, being scored 0.3423913, the most similar ligand is CHEMBL358279. Check out the elaboration below.
| Imatinib (Given Ligand) | CHEMBL358279 (Similar Ligand) |
|---|---|
| Cc3ccc(NC(=O)c2ccc(CN1CCN(C)CC1)cc2)cc3Nc5nccc(c4cccnc4)n5 | NC(=O)c1ccc2c(c1)C(=O)C(=O)N2Cc1ccc2ccccc2c1 |
|
|
|
|
|
|
| 0001e202 00010800 80004100 44050610 09041004 04004000 00002800 02081000 00000100 00010840 00280004 6000d810 82008802 0010a000 00020440 800c0004 00060000 12006004 0c600000 10a00006 40100000 2c02a600 31812860 0240011c 000c0003 c0180000 08000600 800110e0 08c0810c 00460801 c0040800 200002a2 | 1000c002 00800800 00100100 80010600 20001001 00010040 00800000 02081000 04800080 00080e40 08280004 4000f000 03008802 00108000 40020540 08080008 00048000 02000000 08000400 00000200 c0100400 18228608 20012000 8144001d 00000000 c0000280 08000010 80005080 04088100 00060003 a0047000 20000600 |