On Target NS5B_HCV1B 0.3478261/CHEMBL99408
For the given ligand Chloroquine, we have found in our database that, being scored 0.3478261, the most similar ligand is CHEMBL99408. Check out the elaboration below.
| Chloroquine (Given Ligand) | CHEMBL99408 (Similar Ligand) |
|---|---|
| CCN(CC)CCCC(C)Nc1ccnc2cc(Cl)ccc12 | Nc1ccc2ncccc2c1 |
|
|
|
|
|
|
| 0001c002 01000000 00104000 00000600 200c0000 00002000 08008000 20000000 00200000 000008c0 00200004 40038800 02000806 00400000 00020040 00040004 00040000 00000000 08200000 00000201 40100000 18048108 20800000 80100010 00006000 00000000 00008000 10000080 00008000 00060000 00040000 00420240 | 00000002 00800000 00004000 00000200 00040000 00000000 00000000 00000000 00000000 00000840 00000004 00008000 00000800 00400000 00000040 00040004 00000000 00000008 00200000 00000000 40000000 08008008 20800000 80000000 00000000 00000000 00000000 00000000 00000000 00060000 00040000 00000000 |