On Target NS3_HCV1A 0.2951807/CHEMBL3645733
For the given ligand Favipiravir, we have found in our database that, being scored 0.2951807, the most similar ligand is CHEMBL3645733. Check out the elaboration below.
| Favipiravir (Given Ligand) | CHEMBL3645733 (Similar Ligand) |
|---|---|
| NC(=O)c1nc(F)cnc1O | C=C[C@@H]1C[C@]1(NC(=O)[C@@H]1C[C@@]2(CN1C(=O)[C@@H](NC(=O)C(NC(=O)c1cnccn1)C1CCCCC1)C(C)(C)C)C(C)(C)C21CCC1)C(=O)NS(=O)(=O)NC(C)(C)C |
|
|
|
|
|
|
| 00000002 02800018 40100800 14000410 00000040 00020004 0000c002 00401441 10000000 00000000 01090000 40000000 01008000 00103000 40820000 0004200c 08000000 02002000 00000000 00000000 80060000 0040a600 21004000 00000208 00148400 00000000 08000000 10000004 00000004 00060801 80001000 84000200 | 100180a2 09803000 06100800 15200c10 00000040 00100010 000ac000 20003409 10000000 0011c188 01692000 40013000 0601801a 01102011 a0c20400 00040104 0c024000 02000002 46012000 00004201 80000000 30078e30 21004003 32900038 00140000 00000000 08000000 90000014 08000004 c0060881 e4024004 80012260 |