On Target ACE2_HUMAN 0.3030303/CHEMBL76
For the given ligand Enisamium iodide, we have found in our database that, being scored 0.3030303, the most similar ligand is CHEMBL76. Check out the elaboration below.
| Enisamium iodide (Given Ligand) | CHEMBL76 (Similar Ligand) |
|---|---|
| C[n+]2ccc(C(=O)NCc1ccccc1)cc2.[I-] | Clc1cc2nccc(c2cc1)NC(C)CCCN(CC)CC |
|
|
|
|
|
|
| 00000002 00801800 00004100 00010600 00040000 00000000 00000000 02001004 00000000 000008c0 00200004 40018000 80008802 00000000 00000400 00040004 00002008 02800000 00200000 00000000 c0000000 18048610 20800000 0040000c 00004000 c0000000 00000000 80000000 00000100 00060001 802c8000 00000220 | 0001c002 01000000 00104000 00000600 200c0000 00002000 08008000 20000000 00200000 000008c0 00200004 40038800 02000806 00400000 00020040 00040004 00040000 00000000 08200000 00000201 40100000 18048108 20800000 80100010 00006000 00000000 00008000 10000080 00008000 00060000 00040000 00420240 |