On Target NS3_HCV1B 0.35036495/CHEMBL231813
For the given ligand Favipiravir, we have found in our database that, being scored 0.35036495, the most similar ligand is CHEMBL231813. Check out the elaboration below.
| Favipiravir (Given Ligand) | CHEMBL231813 (Similar Ligand) |
|---|---|
| NC(=O)c1nc(F)cnc1O | CCC[C@H](NC(=O)[C@@H]1[C@H]2CCC[C@H]2CN1C(=O)[C@@H](NC(=O)[C@@H](NC(=O)c1cnccn1)C1CCCCC1)C(C)(C)C)C(=O)C(=O)NC1CC1 |
|
|
|
|
|
|
| 00000002 02800018 40100800 14000410 00000040 00020004 0000c002 00401441 10000000 00000000 01090000 40000000 01008000 00103000 40820000 0004200c 08000000 02002000 00000000 00000000 80060000 0040a600 21004000 00000208 00148400 00000000 08000000 10000004 00000004 00060801 80001000 84000200 | 10018002 01803400 00100800 14000c10 00000040 00100010 0000c000 20003009 14000000 000101a0 01290000 40013000 0e00801a 01102001 80820400 00040104 08020000 02000003 02002010 00000201 80000000 300f8e30 21004003 02100018 00141000 00000000 08000000 90000004 08000004 01060811 a0024000 80002200 |