On Target PR_HIV1 0.12307692/CHEMBL510485
For the given ligand Favipiravir, we have found in our database that, being scored 0.12307692, the most similar ligand is CHEMBL510485. Check out the elaboration below.
| Favipiravir (Given Ligand) | CHEMBL510485 (Similar Ligand) |
|---|---|
| NC(=O)c1nc(F)cnc1O | COc1ccc(S(=O)(=O)N(CC(C)C)C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)OC2COCCOCCOCCOC2)cc1 |
|
|
|
|
|
|
| 00000002 02800018 40100800 14000410 00000040 00020004 0000c002 00401441 10000000 00000000 01090000 40000000 01008000 00103000 40820000 0004200c 08000000 02002000 00000000 00000000 80060000 0040a600 21004000 00000208 00148400 00000000 08000000 10000004 00000004 00060801 80001000 84000200 | 00000010 01c05409 2110050a 01b10600 000810c0 00028000 02000000 20000044 00542a00 014809e0 08302000 60018010 00008002 00200001 81e80001 001a8008 10022000 02080000 01400800 01027603 80000120 18280c90 07100040 d9500058 02000400 8000000e 00800000 102000ec 04000600 20060013 80000000 00012670 |