On Target RT_HIV1 0.27705628/CHEMBL4227326
For the given ligand Umifenovir, we have found in our database that, being scored 0.27705628, the most similar ligand is CHEMBL4227326. Check out the elaboration below.
| Umifenovir (Given Ligand) | CHEMBL4227326 (Similar Ligand) |
|---|---|
| CCOC(=O)c2c(CSc1ccccc1)n(C)c3cc(Br)c(O)c(CN(C)C)c23 | C=C(C)[C@@H]1CC[C@]2(CNCCc3ccccn3)CC[C@]3(C)[C@H](CC[C@@H]4[C@@]5(C)CC=C(c6ccc(C(=O)O)cc6)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]12 |
|
|
|
|
|
|
| 00004242 20809a08 20026501 10110630 00041030 0000c000 16100000 02001404 50400100 01014cc0 40600004 e2038808 80009837 40658001 02020140 0a0c200c 24020019 82880304 80210000 40020208 c0002002 1846aa78 20800100 8040000d 00246400 c0002000 084e0040 80000000 04400305 002e0040 d48c820c 09010220 | 0400000a 01000800 00104322 50050600 00040020 00004000 80000080 20000402 00000980 00180ac0 08308004 40818800 00028802 00200000 01020402 020c000c 00000400 0a000020 02212000 00000201 41000100 18228a30 20808020 81500014 01201000 80000000 00406040 d0000000 04400006 01060002 e4020000 20002600 |