On Target RT_HIV1 0.22191781/CHEMBL4108778
For the given ligand Sofosbuvir, we have found in our database that, being scored 0.22191781, the most similar ligand is CHEMBL4108778. Check out the elaboration below.
| Sofosbuvir (Given Ligand) | CHEMBL4108778 (Similar Ligand) |
|---|---|
| CC(C)OC(=O)[C@H](C)NP(=O)(OC[C@H]2O[C@@H](n1ccc(=O)[nH]c1=O)[C@](C)(F)[C@@H]2O)Oc3ccccc3 | COC(=O)N[C@H](C(=O)N[C@H](c1ccc([C@@H](CO)N(CCC(C)(C)C)S(=O)(=O)c2ccn3ncnc3c2)s1)C(F)(F)F)C(c1ccccc1)c1ccccc1 |
|
|
|
|
|
|
| 00200002 01540108 38100910 83010f40 40180074 00084140 02024413 80000020 0f004100 818008f4 0c00100c 4845b168 00009002 03ca0130 00a89080 009c8a8c 002a0030 00008001 29c60000 00025043 a00801a0 1e000a10 27800041 08700010 10040400 c0202002 2f0012a0 10078060 22005281 09460034 55680020 20139684 | 000100d2 00903a08 62184100 0db10601 100c00c0 0003e0e4 06031081 2320580e 00c60b08 c04918c0 09302204 e000b880 8c008813 00e02021 804c2440 001e020c 1842b010 0299000c 00700818 0022660d e0001900 7c288eb0 23900802 d370005c 42000c00 e4010006 40000800 d040282c 0c200380 2046000f e0004000 00d107f0 |