On Target NSP15_SARS 0.23236515/CHEMBL3105073
For the given ligand Umifenovir, we have found in our database that, being scored 0.23236515, the most similar ligand is CHEMBL3105073. Check out the elaboration below.
| Umifenovir (Given Ligand) | CHEMBL3105073 (Similar Ligand) |
|---|---|
| CCOC(=O)c2c(CSc1ccccc1)n(C)c3cc(Br)c(O)c(CN(C)C)c23 | S=C(NCc1cccnc1)SCc1cc(Cl)sc1Cl |
|
|
|
|
|
|
| 00004242 20809a08 20026501 10110630 00041030 0000c000 16100000 02001404 50400100 01014cc0 40600004 e2038808 80009837 40658001 02020140 0a0c200c 24020019 82880304 80210000 40020208 c0002002 1846aa78 20800100 8040000d 00246400 c0002000 084e0040 80000000 04400305 002e0040 d48c820c 09010220 | 10018012 00008008 10006d00 01100610 20149004 00404084 04024000 22001000 00000001 03404040 01200204 40200880 0200180c 000c0001 80001000 00040104 04000400 02000304 00200000 01040208 40100000 48008981 20880020 02400000 05040000 04000200 28000400 a0020404 03603100 00060000 00000011 81c30288 |