On Target NP_HCoV-OC43 0.3125/CHEMBL3233481
For the given ligand Enisamium iodide, we have found in our database that, being scored 0.3125, the most similar ligand is CHEMBL3233481. Check out the elaboration below.
| Enisamium iodide (Given Ligand) | CHEMBL3233481 (Similar Ligand) |
|---|---|
| C[n+]2ccc(C(=O)NCc1ccccc1)cc2.[I-] | CN(C)CC(=O)Nc1ccc2[nH]c(=O)c3ccccc3c2c1.Cl |
|
|
|
|
|
|
| 00000002 00801800 00004100 00010600 00040000 00000000 00000000 02001004 00000000 000008c0 00200004 40018000 80008802 00000000 00000400 00040004 00002008 02800000 00200000 00000000 c0000000 18048610 20800000 0040000c 00004000 c0000000 00000000 80000000 00000100 00060001 802c8000 00000220 | 00004002 00800000 00004020 00000600 00040000 00000060 00000000 00000000 06000000 40000a60 04280004 4000a000 00008800 00702000 00100040 00040004 00040000 00000008 08200000 00000004 40100000 28008608 20802000 80100002 00000000 40000000 00000000 00000080 08008000 00060001 00044000 00020200 |