On Target NS3_HCV1A 0.3127148/CHEMBL3960420
For the given ligand Remdesivir Nucleoside, we have found in our database that, being scored 0.3127148, the most similar ligand is CHEMBL3960420. Check out the elaboration below.
| Remdesivir Nucleoside (Given Ligand) | CHEMBL3960420 (Similar Ligand) |
|---|---|
| N#C[C@@]3(c1ccc2c(N)ncnn12)O[C@H](CO)[C@@H](O)[C@H]3O | COc1ccc(Sc2ccc(C#Cc3ccc(NC(=O)[C@@H]4CCCN4C(=O)OCc4ccccc4)cc3)cc2Nc2ncnc3nc(C(C)C)ccc23)cc1 |
|
|
|
|
|
|
| 0000000a 81004009 e2103502 18010720 052c80f0 8000c004 03018000 00200a00 10400b00 010c0040 08188004 42839040 00001802 02b10000 000e0040 020ea00c 08418800 06800004 01602008 00660201 40120120 3c008060 a5801cc6 08700110 00000400 80002000 080880c0 900008a0 0040020e 00c6cc02 40000280 22200c80 | 1101420a 01c27a08 201a4928 1c190600 24443020 0001e010 02009010 00000808 10802300 00080ad0 08399004 6081b800 0e008813 0091a000 81020441 1a1e000e 04061000 72084400 08600c9a 12220201 c1100000 38848e70 20806041 8258001f 00044004 80002202 02a080d0 102000a0 0a40820c 01460003 e000c000 200106e0 |