On Target PA_INFA 0.23236515/CHEMBL2443239
For the given ligand Remdesivir Nucleoside, we have found in our database that, being scored 0.23236515, the most similar ligand is CHEMBL2443239. Check out the elaboration below.
| Remdesivir Nucleoside (Given Ligand) | CHEMBL2443239 (Similar Ligand) |
|---|---|
| N#C[C@@]3(c1ccc2c(N)ncnn12)O[C@H](CO)[C@@H](O)[C@H]3O | O=c1[nH]c(-c2ccc(F)cc2)c(-c2ccc(-c3nnn[nH]3)cc2)cc1O |
|
|
|
|
|
|
| 0000000a 81004009 e2103502 18010720 052c80f0 8000c004 03018000 00200a00 10400b00 010c0040 08188004 42839040 00001802 02b10000 000e0040 020ea00c 08418800 06800004 01602008 00660201 40120120 3c008060 a5801cc6 08700110 00000400 80002000 080880c0 900008a0 0040020e 00c6cc02 40000280 22200c80 | 00002002 40000019 60104100 12010210 01841028 0400005c 00800800 00280000 06000100 50000860 04008084 40008000 00018894 00201001 20120000 820c200c 00020060 02002804 04200000 10721002 40060120 88008000 3080c000 00504400 00042403 c0280000 18020240 00000041 00404004 00028400 80000a00 08000200 |