On Target PR_HIV1 0.24124514/CHEMBL510485
For the given ligand Remdesivir Nucleoside, we have found in our database that, being scored 0.24124514, the most similar ligand is CHEMBL510485. Check out the elaboration below.
| Remdesivir Nucleoside (Given Ligand) | CHEMBL510485 (Similar Ligand) |
|---|---|
| N#C[C@@]3(c1ccc2c(N)ncnn12)O[C@H](CO)[C@@H](O)[C@H]3O | COc1ccc(S(=O)(=O)N(CC(C)C)C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)OC2COCCOCCOCCOC2)cc1 |
|
|
|
|
|
|
| 0000000a 81004009 e2103502 18010720 052c80f0 8000c004 03018000 00200a00 10400b00 010c0040 08188004 42839040 00001802 02b10000 000e0040 020ea00c 08418800 06800004 01602008 00660201 40120120 3c008060 a5801cc6 08700110 00000400 80002000 080880c0 900008a0 0040020e 00c6cc02 40000280 22200c80 | 00000010 01c05409 2110050a 01b10600 000810c0 00028000 02000000 20000044 00542a00 014809e0 08302000 60018010 00008002 00200001 81e80001 001a8008 10022000 02080000 01400800 01027603 80000120 18280c90 07100040 d9500058 02000400 8000000e 00800000 102000ec 04000600 20060013 80000000 00012670 |