On Target NS5B_HCV1A 0.30402932/CHEMBL353549
For the given ligand Remdesivir Nucleoside, we have found in our database that, being scored 0.30402932, the most similar ligand is CHEMBL353549. Check out the elaboration below.
| Remdesivir Nucleoside (Given Ligand) | CHEMBL353549 (Similar Ligand) |
|---|---|
| N#C[C@@]3(c1ccc2c(N)ncnn12)O[C@H](CO)[C@@H](O)[C@H]3O | O=C(N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)c1ccc2c(c1)nc(-c1ccoc1)n2C1CCCCC1 |
|
|
|
|
|
|
| 0000000a 81004009 e2103502 18010720 052c80f0 8000c004 03018000 00200a00 10400b00 010c0040 08188004 42839040 00001802 02b10000 000e0040 020ea00c 08418800 06800004 01602008 00660201 40120120 3c008060 a5801cc6 08700110 00000400 80002000 080880c0 900008a0 0040020e 00c6cc02 40000280 22200c80 | 0000800a 0120f890 00180100 51850612 200c10e1 00006000 00002000 0220100c 00424980 900918c0 0d30800c 4001b000 5e009c02 00c08800 000204c0 028c000c 10000008 02002004 02e02408 00400201 c0120100 38268e38 23800041 9158001c 00047801 c0004000 08400050 98800000 04400104 04460c43 e00cca00 000006a0 |