On Target PLP_SARS 0.25110132/CHEMBL225515
For the given ligand Remdesivir Nucleoside, we have found in our database that, being scored 0.25110132, the most similar ligand is CHEMBL225515. Check out the elaboration below.
| Remdesivir Nucleoside (Given Ligand) | CHEMBL225515 (Similar Ligand) |
|---|---|
| N#C[C@@]3(c1ccc2c(N)ncnn12)O[C@H](CO)[C@@H](O)[C@H]3O | O=C(Oc1cncc(Cl)c1)c1cc2ccccc2[nH]1 |
|
|
|
|
|
|
| 0000000a 81004009 e2103502 18010720 052c80f0 8000c004 03018000 00200a00 10400b00 010c0040 08188004 42839040 00001802 02b10000 000e0040 020ea00c 08418800 06800004 01602008 00660201 40120120 3c008060 a5801cc6 08700110 00000400 80002000 080880c0 900008a0 0040020e 00c6cc02 40000280 22200c80 | 04008002 00000808 62024108 10010200 00041020 04004044 80080000 01200000 00000300 00000840 00080004 40048800 0680880c 08510002 01030042 020c000c 04028000 02802004 00200008 00020000 40000000 08068b68 b0802002 80c09104 00002c00 80182200 00000200 00000000 00000204 00020001 c0040200 10020000 |