On Target NS5B_HCV1A 0.27522936/CHEMBL176058
For the given ligand Niclosamide, we have found in our database that, being scored 0.27522936, the most similar ligand is CHEMBL176058. Check out the elaboration below.
| Niclosamide (Given Ligand) | CHEMBL176058 (Similar Ligand) |
|---|---|
| O=C(Nc1ccc(N(=O)=O)cc1Cl)c2cc(Cl)ccc2O | CC(C)CCn1c(=O)c(C2=NS(=O)(=O)c3ccccc3N2)c(O)c2ccccc21 |
|
|
|
|
|
|
| 0000c002 08001808 20000100 00010e00 00000100 00020000 0e000000 0a001400 04000000 00000868 04280004 4000c800 02018806 00100001 80100040 00002008 10040000 02000000 08000000 00020000 40100000 08068700 20012000 00410004 00002000 c0000400 00100000 800000a0 00008100 00060801 84040000 00020200 | 10204012 0082d01a 21004102 04b11690 00441002 00000060 06084100 0a001400 06000310 c000c8f3 07202204 6001c000 21009806 02680001 80320044 040c200c 04040110 c2302004 08200000 0006200d c0120000 18018818 20812002 88720018 00044008 c0403000 48800080 940e00c8 00c48118 200600c1 e41ca018 84211a20 |