On Target PR_SARS 0.23684211/CHEMBL2441741
For the given ligand Bazedoxifene, we have found in our database that, being scored 0.23684211, the most similar ligand is CHEMBL2441741. Check out the elaboration below.
| Bazedoxifene (Given Ligand) | CHEMBL2441741 (Similar Ligand) |
|---|---|
| Cc4c(c1ccc(O)cc1)n(Cc3ccc(OCCN2CCCCCC2)cc3)c5ccc(O)cc45 | CC(C)C[C@H](NC(=O)[C@H](Cc1cccc2ccccc12)NC(=O)OCc1ccccc1)C(=O)N[C@H](C=O)C[C@@H]1CCNC1=O |
|
|
|
|
|
|
| 04006002 01000a09 20100108 10010612 200410a0 00000000 06040000 20081000 80100000 100008c0 00200004 40018000 00800836 00608000 210a1041 020c000c 10020000 82802004 04282000 80420203 40100000 18048018 32800000 81500011 00042000 c0000000 08220000 10000041 04004204 00060448 00040a00 00002220 | 01030000 01403200 00100100 04010600 00000000 0001c010 00000000 2000000c 00e00b00 000a08c0 08300000 4003b000 0e00801a 00012001 80000000 021e0008 00020000 02080400 00002898 00000201 00000100 38240e38 00000003 83500018 00000800 80002002 00000000 10200020 0c000200 0006000b e0004000 00802600 |