On Target NS3_HCV1B 0.33939394/CHEMBL3125634
For the given ligand Gilteritinib, we have found in our database that, being scored 0.33939394, the most similar ligand is CHEMBL3125634. Check out the elaboration below.
| Gilteritinib (Given Ligand) | CHEMBL3125634 (Similar Ligand) |
|---|---|
| CCc4nc(C(N)=O)c(Nc3ccc(N2CCC(N1CCN(C)CC1)CC2)c(OC)c3)nc4NC5CCOCC5 | CC(C)(C)NC(=O)Nc1nc(Cl)c(CCC2CCCCC2)n(CC(=O)Nc2ccccc2C(=O)NS(=O)(=O)c2ccc(C(F)(F)F)cc2)c1=O |
|
|
|
|
|
|
| 0000400a 81811409 20100d88 15810730 ae081040 08012052 1200e010 001010c1 10c02100 200809e0 01298024 5003e010 00008002 08182000 01820941 000c400e 08248000 12005000 08c08402 10a22641 e0180020 78048600 210048a1 02108018 00140402 01100000 28000410 100110cc 0808820c 006e1811 c0001400 e0020280 | 1001403a 05801800 011815e2 51b50e30 0408014c 08016040 0500ac05 00883101 16e00a01 f0083af0 08b8a06c 6010b980 05088808 03700801 80a309c2 08140004 8e246080 46504000 8a402408 00a06003 e0120580 78238700 21026800 0860041e 17048802 c1000704 48000410 900010ac 08048c1e 20c61811 803e2000 600383e8 |