On Target RT_HIV1 0.2596154/CHEMBL3683705
For the given ligand Gilteritinib, we have found in our database that, being scored 0.2596154, the most similar ligand is CHEMBL3683705. Check out the elaboration below.
| Gilteritinib (Given Ligand) | CHEMBL3683705 (Similar Ligand) |
|---|---|
| CCc4nc(C(N)=O)c(Nc3ccc(N2CCC(N1CCN(C)CC1)CC2)c(OC)c3)nc4NC5CCOCC5 | COC(=O)N[C@H](C(=O)NCC(F)(F)CC[C@@H](CO)N(Cc1cn[nH]c1)S(=O)(=O)c1ccc2ncsc2c1)C(c1ccccc1)c1ccccc1 |
|
|
|
|
|
|
| 0000400a 81811409 20100d88 15810730 ae081040 08012052 1200e010 001010c1 10c02100 200809e0 01298024 5003e010 00008002 08182000 01820941 000c400e 08248000 12005000 08c08402 10a22641 e0180020 78048600 210048a1 02108018 00140402 01100000 28000410 100110cc 0808820c 006e1811 c0001400 e0020280 | 0003001a 5d803208 21100188 05b10610 000c1080 0001a0c0 04004801 2100900c 00c40a80 804818c0 08302a04 7001b000 0c20a022 00c42001 806024c0 001e140c 10022020 02080080 00602018 00226e01 c0000100 78240eb0 23900a01 db750058 02000800 ac000106 c0000020 d000002c 0c001680 2606000b a0004000 00412670 |