On Target NS5B_HCV1A 0.325/CHEMBL446360
For the given ligand Tetrandrine, we have found in our database that, being scored 0.325, the most similar ligand is CHEMBL446360. Check out the elaboration below.
| Tetrandrine (Given Ligand) | CHEMBL446360 (Similar Ligand) |
|---|---|
| COc1ccc3cc1Oc2ccc(cc2)C[C@H]7c6cc(Oc5c(OC)c(OC)cc4CCN(C)[C@@H](C3)c45)c(OC)cc6CCN7C | N#Cc1ccc(Br)cc1Oc1ccccc1C(=O)CC(=O)C(=O)O |
|
|
|
|
|
|
| 00000009 46000008 20100108 10018600 00001020 c0000102 42040000 02401601 00100884 00180840 08300000 40808840 00004882 20200000 01000401 0000a008 40000200 02000024 00082000 00020a01 00420100 18308100 00404000 81448410 00000000 e8000001 00320000 80200000 04000380 0006000a 24060400 00002700 | 00054004 01008808 2000010a 00018200 00081020 00020002 06404000 00000201 04000904 00880840 0814000a 4000d040 04008012 00200000 01000001 00082008 00400000 02000000 00c02008 00020001 00400100 08020a00 01000400 00400414 00000800 c0000000 00120800 00200000 00000302 00064422 81020408 08400400 |