On Target NS5B_HCV1A 0.3764706/CHEMBL353549
For the given ligand Abemaciclib, we have found in our database that, being scored 0.3764706, the most similar ligand is CHEMBL353549. Check out the elaboration below.
| Abemaciclib (Given Ligand) | CHEMBL353549 (Similar Ligand) |
|---|---|
| CCN5CCN(Cc4ccc(Nc3ncc(F)c(c2cc(F)c1nc(C)n(C(C)C)c1c2)n3)nc4)CC5 | O=C(N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)c1ccc2c(c1)nc(-c1ccoc1)n2C1CCCCC1 |
|
|
|
|
|
|
| 1000a002 00008800 80104180 96050610 010c1064 00106030 00006000 02081000 02000100 004138d0 0130800c 7001c800 02019802 0050b000 00020cc0 021c0004 00060200 12806004 0c600000 10a00006 c0000000 3c02b830 31802861 02700118 01040000 c0000000 080020c0 900100e3 0840c10c 00478800 40081800 e00002a2 | 0000800a 0120f890 00180100 51850612 200c10e1 00006000 00002000 0220100c 00424980 900918c0 0d30800c 4001b000 5e009c02 00c08800 000204c0 028c000c 10000008 02002004 02e02408 00400201 c0120100 38268e38 23800041 9158001c 00047801 c0004000 08400050 98800000 04400104 04460c43 e00cca00 000006a0 |