On Target NS5B_HCV1B 0.32851985/CHEMBL3645200
For the given ligand Abemaciclib, we have found in our database that, being scored 0.32851985, the most similar ligand is CHEMBL3645200. Check out the elaboration below.
| Abemaciclib (Given Ligand) | CHEMBL3645200 (Similar Ligand) |
|---|---|
| CCN5CCN(Cc4ccc(Nc3ncc(F)c(c2cc(F)c1nc(C)n(C(C)C)c1c2)n3)nc4)CC5 | CNC(=O)c1c2cc(C3CC3)c(N(CCCNC(=O)c3cccnc3)S(C)(=O)=O)cc2nn1-c1ccc(Br)cc1 |
|
|
|
|
|
|
| 1000a002 00008800 80104180 96050610 010c1064 00106030 00006000 02081000 02000100 004138d0 0130800c 7001c800 02019802 0050b000 00020cc0 021c0004 00060200 12806004 0c600000 10a00006 c0000000 3c02b830 31802861 02700118 01040000 c0000000 080020c0 900100e3 0840c10c 00478800 40081800 e00002a2 | 10004006 0080de08 20184902 41310e10 210c1000 00004042 02044000 02001408 00100900 004909e0 09312024 40118800 80008c33 01400201 808a0440 000e200e 04268000 02000004 08600008 00225203 e0100101 1c8f8e38 2080c800 9360001c 02144080 c0000048 08270080 8000108c 0c488104 0046005b e4048088 a81147e0 |