On Target NSP15_SARS 0.2735043/CHEMBL471187
For the given ligand Berbamine, we have found in our database that, being scored 0.2735043, the most similar ligand is CHEMBL471187. Check out the elaboration below.
| Berbamine (Given Ligand) | CHEMBL471187 (Similar Ligand) |
|---|---|
| COc4cc5CCN(C)C6Cc1ccc(cc1)Oc2cc(ccc2O)CC7c3c(cc(OC)c(OC)c3Oc4cc56)CCN7C | Oc1cc(O)cc(Oc2c(O)cc(O)c3c2Oc2c(O)cc(O)cc2O3)c1 |
|
|
|
|
|
|
| 00000009 46000008 20100108 10018600 00001020 c0000102 42040000 02401601 00100884 00180840 08300000 40808840 00004882 20200000 01000401 0000a008 40000200 02000024 00082000 00020a01 00420100 18308100 00404000 81448410 00000000 e8000001 00320000 80200000 04000380 0006000a 24060400 00002700 | 00000001 00000008 20000008 00000200 00001000 00000000 42000000 00000000 00100000 00000840 00000000 00008800 00004002 00000000 01000001 00008008 00000000 00000004 00002000 00020800 00400000 08000100 00000000 00000000 00000000 20000000 00080000 00200000 80000200 00020008 00000400 02000000 |