On Target NP_HCoV-OC43 0.20833333/CHEMBL3233481
For the given ligand Abemaciclib, we have found in our database that, being scored 0.20833333, the most similar ligand is CHEMBL3233481. Check out the elaboration below.
| Abemaciclib (Given Ligand) | CHEMBL3233481 (Similar Ligand) |
|---|---|
| CCN5CCN(Cc4ccc(Nc3ncc(F)c(c2cc(F)c1nc(C)n(C(C)C)c1c2)n3)nc4)CC5 | CN(C)CC(=O)Nc1ccc2[nH]c(=O)c3ccccc3c2c1.Cl |
|
|
|
|
|
|
| 1000a002 00008800 80104180 96050610 010c1064 00106030 00006000 02081000 02000100 004138d0 0130800c 7001c800 02019802 0050b000 00020cc0 021c0004 00060200 12806004 0c600000 10a00006 c0000000 3c02b830 31802861 02700118 01040000 c0000000 080020c0 900100e3 0840c10c 00478800 40081800 e00002a2 | 00004002 00800000 00004020 00000600 00040000 00000060 00000000 00000000 06000000 40000a60 04280004 4000a000 00008800 00702000 00100040 00040004 00040000 00000008 08200000 00000004 40100000 28008608 20802000 80100002 00000000 40000000 00000000 00000080 08008000 00060001 00044000 00020200 |