On Target PLP_SARS 0.2590909/CHEMBL358279
For the given ligand Abemaciclib, we have found in our database that, being scored 0.2590909, the most similar ligand is CHEMBL358279. Check out the elaboration below.
| Abemaciclib (Given Ligand) | CHEMBL358279 (Similar Ligand) |
|---|---|
| CCN5CCN(Cc4ccc(Nc3ncc(F)c(c2cc(F)c1nc(C)n(C(C)C)c1c2)n3)nc4)CC5 | NC(=O)c1ccc2c(c1)C(=O)C(=O)N2Cc1ccc2ccccc2c1 |
|
|
|
|
|
|
| 1000a002 00008800 80104180 96050610 010c1064 00106030 00006000 02081000 02000100 004138d0 0130800c 7001c800 02019802 0050b000 00020cc0 021c0004 00060200 12806004 0c600000 10a00006 c0000000 3c02b830 31802861 02700118 01040000 c0000000 080020c0 900100e3 0840c10c 00478800 40081800 e00002a2 | 1000c002 00800800 00100100 80010600 20001001 00010040 00800000 02081000 04800080 00080e40 08280004 4000f000 03008802 00108000 40020540 08080008 00048000 02000000 08000400 00000200 c0100400 18228608 20012000 8144001d 00000000 c0000280 08000010 80005080 04088100 00060003 a0047000 20000600 |