On Target NS3_HCV1A 0.22905028/CHEMBL3645746
For the given ligand Salinomycin, we have found in our database that, being scored 0.22905028, the most similar ligand is CHEMBL3645746. Check out the elaboration below.
| Salinomycin (Given Ligand) | CHEMBL3645746 (Similar Ligand) |
|---|---|
| CCC(C(=O)O)C5CCC(C)[C@H]([C@@H](C)[C@H](O)[C@H](C)C(=O)[C@H](CC)[C@H]4O[C@]3(/C=C\[C@@H](O)[C@]2(CC[C@@](C)([C@H]1CC[C@](O)(CC)[C@H](C)O1)O2)O3)[C@H](C)C[C@@H]4C)O5 | C=C[C@@H]1C[C@]1(NC(=O)[C@@H]1C[C@@]2(CN1C(=O)[C@@H](NC(=O)[C@@H](NC(=O)CC1CCCCO1)C1CCCCC1)C(C)(C)C)C(C)(C)C21CCC1)C(=O)NS(=O)(=O)N1CCCC1 |
|
|
|
|
|
|
| 00050040 01000000 00000800 00810100 803c0140 00a00800 02002800 28000442 00202000 011000a0 40000200 40019001 1c028028 02800000 00080404 002a9008 00800000 00000000 3140a010 00008001 20100020 00001a10 0500a000 08100010 00201400 00001400 00404002 a4000020 00000200 00000000 24220000 00000010 | 000100e0 09003000 06100100 05210500 800c0000 00200010 000a0000 20001408 10000000 0010c188 00602000 4001b000 1601801a 01882011 a0400400 00081008 04204000 00000000 46c12000 00004201 00000020 30040630 01000083 32900038 00000401 00000000 00000000 90000010 08000200 c0040081 64024004 00012260 |