On Target NS3_HCV1A 0.34065935/CHEMBL4114232
For the given ligand Cepharanthine, we have found in our database that, being scored 0.34065935, the most similar ligand is CHEMBL4114232. Check out the elaboration below.
| Cepharanthine (Given Ligand) | CHEMBL4114232 (Similar Ligand) |
|---|---|
| COc1ccc7cc1Oc2ccc(cc2)CC8c4c(cc3OCOc3c4Oc5cc6c(cc5OC)CCN(C)C6C7)CCN8C | CC[C@@H](N[C@H](C)CC(N)=O)c1ccc(OC)c(C(=O)c2ccc(C#N)cc2)c1F |
|
|
|
|
|
|
| 00000009 46000008 20100108 10818600 00001120 c0000102 42040000 02401601 00300884 00180840 48300000 40808840 00004882 20200000 01000401 0020a008 40000200 02000024 00082000 00020a01 00460300 18308100 00404000 81448410 40002000 e8000001 00320000 a0200000 05040380 0006000a 24060400 00012700 | 000000c0 00000c08 20100108 42010600 00001221 00020010 12040000 03001200 00000900 00888fc0 08300000 40809a00 0c008842 00001000 01000401 08082008 03400200 02000000 00800410 00020201 00000100 18028600 01000400 32400014 00001000 e0000000 08320800 c0800001 00000380 00068412 a2040010 00002600 |