On Target NS3_HCV1B 0.2327044/CHEMBL3927196
For the given ligand Salinomycin, we have found in our database that, being scored 0.2327044, the most similar ligand is CHEMBL3927196. Check out the elaboration below.
| Salinomycin (Given Ligand) | CHEMBL3927196 (Similar Ligand) |
|---|---|
| CCC(C(=O)O)C5CCC(C)[C@H]([C@@H](C)[C@H](O)[C@H](C)C(=O)[C@H](CC)[C@H]4O[C@]3(/C=C\[C@@H](O)[C@]2(CC[C@@](C)([C@H]1CC[C@](O)(CC)[C@H](C)O1)O2)O3)[C@H](C)C[C@@H]4C)O5 | CC(C)=CC(=O)CC[C@H](NC(=O)OC(C)(C)C)C(=O)N1CC2[C@@H]([C@H]1C(=O)NC(CC1CCC1)C(=O)C(N)=O)C2(C)C |
|
|
|
|
|
|
| 00050040 01000000 00000800 00810100 803c0140 00a00800 02002800 28000442 00202000 011000a0 40000200 40019001 1c028028 02800000 00080404 002a9008 00800000 00000000 3140a010 00008001 20100020 00001a10 0500a000 08100010 00201400 00001400 00404002 a4000020 00000200 00000000 24220000 00000010 | 00030000 01403400 00100000 04000600 00000000 00018010 00000000 20000408 05800200 00120180 00200000 5001b000 0e02801a 01002011 80000400 001a0008 00020000 00080001 00012810 00000201 00000000 300c0e70 00008003 02100018 00001000 00000002 00404000 90200020 08000200 00040011 a4024000 00802200 |