On Target NS3_HCV1B 0.20967741/CHEMBL1170408
For the given ligand Oxyclozanide, we have found in our database that, being scored 0.20967741, the most similar ligand is CHEMBL1170408. Check out the elaboration below.
| Oxyclozanide (Given Ligand) | CHEMBL1170408 (Similar Ligand) |
|---|---|
| O=C(Nc1cc(Cl)cc(Cl)c1O)c2c(O)c(Cl)cc(Cl)c2Cl | C=CCCCS(=O)(=O)NC(=O)[C@H](CCC)NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)OC(C)(C)C)C(C)(C)C)c1ccc(Oc2cc(-c3ccccc3)nc3cc(OC)ccc23)c(C=C)c1 |
|
|
|
|
|
|
| 0000c002 08000808 20000100 01010600 00000000 00020020 1e000000 02001400 00000000 00000848 00280004 4000c800 02008806 00100403 81000040 00006008 00040000 07000000 08000000 00024000 40100800 08028700 20012000 00408004 00002000 80100a00 20100040 80000080 00008100 00060801 8c040000 00020200 | 08012082 65c03008 20184108 15310600 00241021 00018000 96060080 22081408 20800284 105988c0 08202404 4011b000 0f00c802 00442001 c1420441 025ea00c 02020040 02082004 04282810 00465a01 c0400000 bc248e19 30800103 b3440038 02000000 c0000002 08322048 9020406c 0c404384 00260403 a4067c00 01252670 |