On Target PA_INFA 0.28787878/CHEMBL2040552
For the given ligand Oxyclozanide, we have found in our database that, being scored 0.28787878, the most similar ligand is CHEMBL2040552. Check out the elaboration below.
| Oxyclozanide (Given Ligand) | CHEMBL2040552 (Similar Ligand) |
|---|---|
| O=C(Nc1cc(Cl)cc(Cl)c1O)c2c(O)c(Cl)cc(Cl)c2Cl | O=C(O)/C(O)=C/C(=O)c1ccc(N2CCNCC2)cc1 |
|
|
|
|
|
|
| 0000c002 08000808 20000100 01010600 00000000 00020020 1e000000 02001400 00000000 00000848 00280004 4000c800 02008806 00100403 81000040 00006008 00040000 07000000 08000000 00024000 40100800 08028700 20012000 00408004 00002000 80100a00 20100040 80000080 00008100 00060801 8c040000 00020200 | 00004002 00000800 00000120 c4010600 00000000 00800000 00000001 00000400 01000000 00980a40 08200004 4000c000 80008002 0000a000 00000040 00080008 00040400 02100000 08250010 00000800 40100000 38020a80 24008020 02400016 00001000 84004400 00400000 00000080 0800c000 00060002 84000000 00000600 |