On Target GP_EBOV 0.27083334/CHEMBL112570
For the given ligand Ciclesonide, we have found in our database that, being scored 0.27083334, the most similar ligand is CHEMBL112570. Check out the elaboration below.
| Ciclesonide (Given Ligand) | CHEMBL112570 (Similar Ligand) |
|---|---|
| CC(C)C(=O)OCC(=O)[C@@]26O[C@H](C1CCCCC1)O[C@@H]2C[C@H]5[C@@H]4CC/C3=C/C(=O)/C=C\[C@]3(C)[C@H]4[C@@H](O)C[C@@]56C | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@@]21C |
|
|
|
|
|
|
| 00010042 81000000 00000100 00090300 003c0040 00200004 00000880 0a000402 01200000 01100020 00000000 4000d000 14028028 02800000 00000400 08289008 00820000 80000000 1341a000 00022001 00000021 10000a80 05008000 08000814 00200400 00000000 00404000 a4000020 00000200 0100000a 24a20000 02000000 | 00000000 01000000 00000800 00000000 00080000 00000000 00000000 00000402 00000000 00100008 00000200 40000000 00020000 00800000 00000404 00080008 00000000 00000020 02402000 00000001 00000000 00000000 01008000 00000010 00200000 00000000 00404000 80000000 00000000 01000000 24020000 00000000 |