On Target PR_HIV1 0.16666667/CHEMBL523528
For the given ligand Oxyclozanide, we have found in our database that, being scored 0.16666667, the most similar ligand is CHEMBL523528. Check out the elaboration below.
| Oxyclozanide (Given Ligand) | CHEMBL523528 (Similar Ligand) |
|---|---|
| O=C(Nc1cc(Cl)cc(Cl)c1O)c2c(O)c(Cl)cc(Cl)c2Cl | COc1ccc(S(=O)(=O)N(CC(C)C)C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)OC2COCOC2)cc1 |
|
|
|
|
|
|
| 0000c002 08000808 20000100 01010600 00000000 00020020 1e000000 02001400 00000000 00000848 00280004 4000c800 02008806 00100403 81000040 00006008 00040000 07000000 08000000 00024000 40100800 08028700 20012000 00408004 00002000 80100a00 20100040 80000080 00008100 00060801 8c040000 00020200 | 00000010 01c05409 2110050a 01b10600 00081080 00028000 02802800 20000004 00742a00 014809e0 08302000 60018010 00008002 00200001 81e80001 003a0008 10022000 02080000 01400800 01027603 80100100 18280c90 07100040 d9500058 02000000 8000000e 00800000 342000cc 04000600 20060013 80000000 00012670 |