On Target RT_HIV1 0.2827225/CHEMBL4227326
For the given ligand Cepharanthine, we have found in our database that, being scored 0.2827225, the most similar ligand is CHEMBL4227326. Check out the elaboration below.
| Cepharanthine (Given Ligand) | CHEMBL4227326 (Similar Ligand) |
|---|---|
| COc1ccc7cc1Oc2ccc(cc2)CC8c4c(cc3OCOc3c4Oc5cc6c(cc5OC)CCN(C)C6C7)CCN8C | C=C(C)[C@@H]1CC[C@]2(CNCCc3ccccn3)CC[C@]3(C)[C@H](CC[C@@H]4[C@@]5(C)CC=C(c6ccc(C(=O)O)cc6)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]12 |
|
|
|
|
|
|
| 00000009 46000008 20100108 10818600 00001120 c0000102 42040000 02401601 00300884 00180840 48300000 40808840 00004882 20200000 01000401 0020a008 40000200 02000024 00082000 00020a01 00460300 18308100 00404000 81448410 40002000 e8000001 00320000 a0200000 05040380 0006000a 24060400 00012700 | 0400000a 01000800 00104322 50050600 00040020 00004000 80000080 20000402 00000980 00180ac0 08308004 40818800 00028802 00200000 01020402 020c000c 00000400 0a000020 02212000 00000201 41000100 18228a30 20808020 81500014 01201000 80000000 00406040 d0000000 04400006 01060002 e4020000 20002600 |