On Target RT_HIV1 0.4375/CHEMBL404519
For the given ligand Ciclesonide, we have found in our database that, being scored 0.4375, the most similar ligand is CHEMBL404519. Check out the elaboration below.
| Ciclesonide (Given Ligand) | CHEMBL404519 (Similar Ligand) |
|---|---|
| CC(C)C(=O)OCC(=O)[C@@]26O[C@H](C1CCCCC1)O[C@@H]2C[C@H]5[C@@H]4CC/C3=C/C(=O)/C=C\[C@]3(C)[C@H]4[C@@H](O)C[C@@]56C | C=C(C)[C@@H]1CC[C@]2(C(=O)O)CC[C@]3(C)[C@H](CC[C@@H]4[C@@]5(C)CC[C@H](OC(=O)CC(C)(C)C(=O)O)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]12 |
|
|
|
|
|
|
| 00010042 81000000 00000100 00090300 003c0040 00200004 00000880 0a000402 01200000 01100020 00000000 4000d000 14028028 02800000 00000400 08289008 00820000 80000000 1341a000 00022001 00000021 10000a80 05008000 08000814 00200400 00000000 00404000 a4000020 00000200 0100000a 24a20000 02000000 | 00050040 01000000 00000100 00010300 00280000 00000000 00000000 00000400 00000000 00108008 00000000 40009000 04008008 00800000 00000400 00081008 00820000 00000100 12402000 00000001 00000020 00000a00 01000000 00000010 00000400 00000000 00000000 80000000 00000202 01000002 24020000 00000000 |