On Target NS5B_HCV1B 0.27306274/CHEMBL3645195
For the given ligand Cepharanthine, we have found in our database that, being scored 0.27306274, the most similar ligand is CHEMBL3645195. Check out the elaboration below.
| Cepharanthine (Given Ligand) | CHEMBL3645195 (Similar Ligand) |
|---|---|
| COc1ccc7cc1Oc2ccc(cc2)CC8c4c(cc3OCOc3c4Oc5cc6c(cc5OC)CCN(C)C6C7)CCN8C | CNC(=O)c1c2cc(C3CC3)c(N(CCCNC(=O)c3ccnc(OC)c3)S(C)(=O)=O)cc2nn1-c1ccc(Br)cc1 |
|
|
|
|
|
|
| 00000009 46000008 20100108 10818600 00001120 c0000102 42040000 02401601 00300884 00180840 48300000 40808840 00004882 20200000 01000401 0020a008 40000200 02000024 00082000 00020a01 00460300 18308100 00404000 81448410 40002000 e8000001 00320000 a0200000 05040380 0006000a 24060400 00012700 | 00004006 4480de18 2018490a 41310e00 a10c1000 00004142 06040000 0200140c 00100900 004909e0 09312024 40118800 80008c33 01400201 a18a4541 201e200e 14268008 02000004 08680008 00225203 e0120101 1c8b8e38 2080c800 9364801c 02104080 c0000048 00270080 8000108c 0d488304 0046005b e4048088 ac1147e0 |