On Target NA_INFB 0.21182266/CHEMBL113191
For the given ligand Cepharanthine, we have found in our database that, being scored 0.21182266, the most similar ligand is CHEMBL113191. Check out the elaboration below.
| Cepharanthine (Given Ligand) | CHEMBL113191 (Similar Ligand) |
|---|---|
| COc1ccc7cc1Oc2ccc(cc2)CC8c4c(cc3OCOc3c4Oc5cc6c(cc5OC)CCN(C)C6C7)CCN8C | CC(=O)N[C@@H]1[C@@H](N)CC(C(=O)O)=C[C@H]1N(C)CCc1ccccc1 |
|
|
|
|
|
|
| 00000009 46000008 20100108 10818600 00001120 c0000102 42040000 02401601 00300884 00180840 48300000 40808840 00004882 20200000 01000401 0020a008 40000200 02000024 00082000 00020a01 00460300 18308100 00404000 81448410 40002000 e8000001 00320000 a0200000 05040380 0006000a 24060400 00012700 | 00030010 0900b400 00100100 04010600 00180000 00000000 00180180 3800040a 11000080 001809c8 08200000 41019000 0402811a 01812000 00000400 00080308 20004000 02000160 40412010 00000201 00000000 38240f90 01008001 83500018 00001000 88008c00 00484000 90000000 0c000000 00060413 04020000 02002600 |